C13H8INO3S — CID 79686040
6-(5-iodothiophene-3-carbonyl)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 79686040) has the molecular formula C13H8INO3S and a molecular weight of 385.18 g/mol. Its IUPAC name is 6-(5-iodothiophene-3-carbonyl)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(5-iodothiophene-3-carbonyl)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 79686040 |
| Molecular Formula | C13H8INO3S |
| Molecular Weight | 385.18 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 6-(5-iodothiophene-3-carbonyl)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(C(=O)c3csc(I)c3)ccc21 |
| InChI | InChI=1S/C13H8INO3S/c1-15-9-3-2-7(4-10(9)18-13(15)17)12(16)8-5-11(14)19-6-8/h2-6H,1H3 |
| InChIKey | PGQYLFGOJPOBIJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.18 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|