C15H15IN2O2S — CID 79691305
6-[ethylamino-(5-iodothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 79691305) has the molecular formula C15H15IN2O2S and a molecular weight of 414.27 g/mol. Its IUPAC name is 6-[ethylamino-(5-iodothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[ethylamino-(5-iodothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 79691305 |
| Molecular Formula | C15H15IN2O2S |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 6-[ethylamino-(5-iodothiophen-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | CCNC(c1csc(I)c1)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C15H15IN2O2S/c1-3-17-14(10-7-13(16)21-8-10)9-4-5-11-12(6-9)20-15(19)18(11)2/h4-8,14,17H,3H2,1-2H3 |
| InChIKey | CDDMIJRDCMKMRR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|