C10H11NO2S — CID 62299003
3-propyl-6-sulfanyl-1,3-benzoxazol-2-one (PubChem CID 62299003) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-propyl-6-sulfanyl-1,3-benzoxazol-2-one.
| Compound Name | 3-propyl-6-sulfanyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 62299003 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3-propyl-6-sulfanyl-1,3-benzoxazol-2-one |
| SMILES | CCCn1c(=O)oc2cc(S)ccc21 |
| InChI | InChI=1S/C10H11NO2S/c1-2-5-11-8-4-3-7(14)6-9(8)13-10(11)12/h3-4,6,14H,2,5H2,1H3 |
| InChIKey | BLQMGNINBNGZCM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|