C16H24BNO3S — CID 123766317
3-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-1,3-benzothiazole (PubChem CID 123766317) has the molecular formula C16H24BNO3S and a molecular weight of 321.25 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-1,3-benzothiazole.
| Compound Name | 3-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 123766317 |
| Molecular Formula | C16H24BNO3S |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 3-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-1,3-benzothiazole |
| SMILES | COCCN1CSc2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C16H24BNO3S/c1-15(2)16(3,4)21-17(20-15)12-6-7-14-13(10-12)18(11-22-14)8-9-19-5/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | NFKIKYZCAITKPV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|