C36H42BBr2N3O4 — CID 162226182
6-bromo-1H-indole;6-bromo-1-(2-methoxyethyl)indole;1-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 162226182) has the molecular formula C36H42BBr2N3O4 and a molecular weight of 751.37 g/mol. Its IUPAC name is 6-bromo-1H-indole;6-bromo-1-(2-methoxyethyl)indole;1-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 6-bromo-1H-indole;6-bromo-1-(2-methoxyethyl)indole;1-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 162226182 |
| Molecular Formula | C36H42BBr2N3O4 |
| Molecular Weight | 751.37 g/mol |
| Exact Mass | 749.16 |
| IUPAC Name | 6-bromo-1H-indole;6-bromo-1-(2-methoxyethyl)indole;1-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | Brc1ccc2cc[nH]c2c1.COCCn1ccc2ccc(B3OC(C)(C)C(C)(C)O3)cc21.COCCn1ccc2ccc(Br)cc21 |
| InChI | InChI=1S/C17H24BNO3.C11H12BrNO.C8H6BrN/c1-16(2)17(3,4)22-18(21-16)14-7-6-13-8-9-19(10-11-20-5)15(13)12-14;1-14-7-6-13-5-4-9-2-3-10(12)8-11(9)13;9-7-2-1-6-3-4-10-8(6)5-7/h6-9,12H,10-11H2,1-5H3;2-5,8H,6-7H2,1H3;1-5,10H |
| InChIKey | ZUUIHBOFRXVPMD-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 62.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.37 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|