C14H18BNO3S — CID 59535313
3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-one (PubChem CID 59535313) has the molecular formula C14H18BNO3S and a molecular weight of 291.18 g/mol. Its IUPAC name is 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-one.
| Compound Name | 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 59535313 |
| Molecular Formula | C14H18BNO3S |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-one |
| SMILES | Cn1c(=O)sc2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C14H18BNO3S/c1-13(2)14(3,4)19-15(18-13)9-6-7-10-11(8-9)20-12(17)16(10)5/h6-8H,1-5H3 |
| InChIKey | BVILCLMTYIQVGY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|