C8H5Cl2NO2 — CID 82184528
5,6-dichloro-3-methyl-1,3-benzoxazol-2-one (PubChem CID 82184528) has the molecular formula C8H5Cl2NO2 and a molecular weight of 218.04 g/mol. Its IUPAC name is 5,6-dichloro-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 5,6-dichloro-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82184528 |
| Molecular Formula | C8H5Cl2NO2 |
| Molecular Weight | 218.04 g/mol |
| Exact Mass | 216.97 |
| IUPAC Name | 5,6-dichloro-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C8H5Cl2NO2/c1-11-6-2-4(9)5(10)3-7(6)13-8(11)12/h2-3H,1H3 |
| InChIKey | OAULZKMEYGPRFJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.04 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |