C10H12N2O2 — CID 117043635
5-(dimethylamino)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 117043635) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 5-(dimethylamino)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 5-(dimethylamino)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 117043635 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 5-(dimethylamino)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | CN(C)c1ccc2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C10H12N2O2/c1-11(2)7-4-5-9-8(6-7)12(3)10(13)14-9/h4-6H,1-3H3 |
| InChIKey | OALFNOATBOBMRW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |