C11H9N3O3 — CID 115172068
1-cyano-N-methyl-N-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)formamide (PubChem CID 115172068) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 1-cyano-N-methyl-N-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)formamide.
| Compound Name | 1-cyano-N-methyl-N-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)formamide |
|---|---|
| PubChem CID | 115172068 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 1-cyano-N-methyl-N-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)formamide |
| SMILES | CN(C(=O)C#N)c1ccc2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C11H9N3O3/c1-13(10(15)6-12)7-3-4-9-8(5-7)14(2)11(16)17-9/h3-5H,1-2H3 |
| InChIKey | XFHPRGMKQWHRTN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|