C10H13NO2 — CID 160664134
3,5-dimethyl-1,3-benzoxazol-2-one;methane (PubChem CID 160664134) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 3,5-dimethyl-1,3-benzoxazol-2-one;methane.
| Compound Name | 3,5-dimethyl-1,3-benzoxazol-2-one;methane |
|---|---|
| PubChem CID | 160664134 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 3,5-dimethyl-1,3-benzoxazol-2-one;methane |
| SMILES | C.Cc1ccc2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C9H9NO2.CH4/c1-6-3-4-8-7(5-6)10(2)9(11)12-8;/h3-5H,1-2H3;1H4 |
| InChIKey | RMBJASZOPWNPJI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |