C15H13NO2 — CID 134527822
3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one (PubChem CID 134527822) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 134527822 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one |
| SMILES | Cc1ccc(-c2ccc3oc(=O)n(C)c3c2)cc1 |
| InChI | InChI=1S/C15H13NO2/c1-10-3-5-11(6-4-10)12-7-8-14-13(9-12)16(2)15(17)18-14/h3-9H,1-2H3 |
| InChIKey | KBZSOIRHGOGKJY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |