C22H29N3O2S — CID 170754542
ethane;3-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]-2-(methylsulfanylamino)propanenitrile (PubChem CID 170754542) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is ethane;3-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]-2-(methylsulfanylamino)propanenitrile.
| Compound Name | ethane;3-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]-2-(methylsulfanylamino)propanenitrile |
|---|---|
| PubChem CID | 170754542 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | ethane;3-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]-2-(methylsulfanylamino)propanenitrile |
| SMILES | CC.CC.CSNC(C#N)Cc1ccc(-c2ccc3oc(=O)n(C)c3c2)cc1 |
| InChI | InChI=1S/C18H17N3O2S.2C2H6/c1-21-16-10-14(7-8-17(16)23-18(21)22)13-5-3-12(4-6-13)9-15(11-19)20-24-2;2*1-2/h3-8,10,15,20H,9H2,1-2H3;2*1-2H3 |
| InChIKey | APOBBXWYACYRAK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 70.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|