C24H24N4O4 — CID 170754294
(2R,3aS,6aR)-N-[(1S)-1-cyano-2-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]ethyl]-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrole-2-carboxamide (PubChem CID 170754294) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is (2R,3aS,6aR)-N-[(1S)-1-cyano-2-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]ethyl]-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrole-2-carboxamide.
| Compound Name | (2R,3aS,6aR)-N-[(1S)-1-cyano-2-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]ethyl]-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 170754294 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (2R,3aS,6aR)-N-[(1S)-1-cyano-2-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]ethyl]-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrole-2-carboxamide |
| SMILES | Cn1c(=O)oc2ccc(-c3ccc(C[C@@H](C#N)NC(=O)[C@H]4C[C@@H]5COC[C@@H]5N4)cc3)cc21 |
| InChI | InChI=1S/C24H24N4O4/c1-28-21-10-16(6-7-22(21)32-24(28)30)15-4-2-14(3-5-15)8-18(11-25)26-23(29)19-9-17-12-31-13-20(17)27-19/h2-7,10,17-20,27H,8-9,12-13H2,1H3,(H,26,29)/t17-,18+,19-,20+/m1/s1 |
| InChIKey | NXIQEAQUOGZJGG-WCIQWLHISA-N |
| XLogP | 1.73 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |