C24H20B3FN4O4 — CID 170754731
CID 170754731 (PubChem CID 170754731) has the molecular formula C24H20B3FN4O4 and a molecular weight of 479.88 g/mol.
| Compound Name | CID 170754731 |
|---|---|
| PubChem CID | 170754731 |
| Molecular Formula | C24H20B3FN4O4 |
| Molecular Weight | 479.88 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])n1c(=O)oc2ccc(-c3ccc(CC(C#N)NC(=O)C4CC5COCC5N4)c(F)c3)cc21 |
| InChI | InChI=1S/C24H20B3FN4O4/c25-24(26,27)32-20-8-13(3-4-21(20)36-23(32)34)12-1-2-14(17(28)6-12)5-16(9-29)30-22(33)18-7-15-10-35-11-19(15)31-18/h1-4,6,8,15-16,18-19,31H,5,7,10-11H2,(H,30,33) |
| InChIKey | WULZACRIEGBIBN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.88 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|