C21H20N4O2S — CID 170754362
(3aS,6aR)-N-[(1S)-1-cyano-2-[5-(4-cyanophenyl)thiophen-2-yl]ethyl]-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrole-2-carboxamide (PubChem CID 170754362) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is (3aS,6aR)-N-[(1S)-1-cyano-2-[5-(4-cyanophenyl)thiophen-2-yl]ethyl]-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrole-2-carboxamide.
| Compound Name | (3aS,6aR)-N-[(1S)-1-cyano-2-[5-(4-cyanophenyl)thiophen-2-yl]ethyl]-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 170754362 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (3aS,6aR)-N-[(1S)-1-cyano-2-[5-(4-cyanophenyl)thiophen-2-yl]ethyl]-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrole-2-carboxamide |
| SMILES | N#Cc1ccc(-c2ccc(C[C@@H](C#N)NC(=O)C3C[C@@H]4COC[C@@H]4N3)s2)cc1 |
| InChI | InChI=1S/C21H20N4O2S/c22-9-13-1-3-14(4-2-13)20-6-5-17(28-20)8-16(10-23)24-21(26)18-7-15-11-27-12-19(15)25-18/h1-6,15-16,18-19,25H,7-8,11-12H2,(H,24,26)/t15-,16+,18?,19+/m1/s1 |
| InChIKey | BOJASERIBYIDEY-BAAURWIGSA-N |
| XLogP | 2.21 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |