C24H21B2FN4O5 — CID 170754550
CID 170754550 (PubChem CID 170754550) has the molecular formula C24H21B2FN4O5 and a molecular weight of 486.08 g/mol.
| Compound Name | CID 170754550 |
|---|---|
| PubChem CID | 170754550 |
| Molecular Formula | C24H21B2FN4O5 |
| Molecular Weight | 486.08 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)n1c(=O)oc2ccc(-c3ccc(C[C@@H](C#N)NC(=O)[C@@H]4C[C@@H]5COC[C@@H]5N4)c(F)c3)cc21 |
| InChI | InChI=1S/C24H21B2FN4O5/c25-24(26,34)31-20-8-13(3-4-21(20)36-23(31)33)12-1-2-14(17(27)6-12)5-16(9-28)29-22(32)18-7-15-10-35-11-19(15)30-18/h1-4,6,8,15-16,18-19,30,34H,5,7,10-11H2,(H,29,32)/t15-,16+,18+,19+/m1/s1 |
| InChIKey | HQOLGCSWZGLODX-NEPXVJNWSA-N |
| XLogP | 0.23 |
| TPSA | 129.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.08 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|