C49H49B3N8O6 — CID 170754659
CID 170754659 (PubChem CID 170754659) has the molecular formula C49H49B3N8O6 and a molecular weight of 878.42 g/mol.
| Compound Name | CID 170754659 |
|---|---|
| PubChem CID | 170754659 |
| Molecular Formula | C49H49B3N8O6 |
| Molecular Weight | 878.42 g/mol |
| Exact Mass | 878.41 |
| IUPAC Name | — |
| SMILES | CC.N#Cc1ccc(-c2ccc(CC(C#N)NC(=O)C3CC4COCC4N3)cc2)cc1.[B]C([B])([B])n1c(=O)oc2ccc(-c3ccc(CC(C#N)NC(=O)C4CC5COCC5N4)cc3)cc21 |
| InChI | InChI=1S/C24H21B3N4O4.C23H22N4O2.C2H6/c25-24(26,27)31-20-9-15(5-6-21(20)35-23(31)33)14-3-1-13(2-4-14)7-17(10-28)29-22(32)18-8-16-11-34-12-19(16)30-18;24-11-16-3-7-18(8-4-16)17-5-1-15(2-6-17)9-20(12-25)26-23(28)21-10-19-13-29-14-22(19)27-21;1-2/h1-6,9,16-19,30H,7-8,11-12H2,(H,29,32);1-8,19-22,27H,9-10,13-14H2,(H,26,28);1-2H3 |
| InChIKey | PDROAFZJTCBSTN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 207.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|