C21H17B3N4O3 — CID 170754218
CID 170754218 (PubChem CID 170754218) has the molecular formula C21H17B3N4O3 and a molecular weight of 405.83 g/mol.
| Compound Name | CID 170754218 |
|---|---|
| PubChem CID | 170754218 |
| Molecular Formula | C21H17B3N4O3 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])n1c(=O)oc2ccc(-c3ccc(CC(C#N)NC(=O)C4CNC4)cc3)cc21 |
| InChI | InChI=1S/C21H17B3N4O3/c22-21(23,24)28-17-8-14(5-6-18(17)31-20(28)30)13-3-1-12(2-4-13)7-16(9-25)27-19(29)15-10-26-11-15/h1-6,8,15-16,26H,7,10-11H2,(H,27,29) |
| InChIKey | MTMPIVWFOPIGPH-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|