C42H48F4N2Si2 — CID 122224272
tri(propan-2-yl)-[2-[8,9,10,11-tetrafluoro-6-[2-tri(propan-2-yl)silylethynyl]anthra[3,2-g]quinoxalin-13-yl]ethynyl]silane (PubChem CID 122224272) has the molecular formula C42H48F4N2Si2 and a molecular weight of 713.02 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-[8,9,10,11-tetrafluoro-6-[2-tri(propan-2-yl)silylethynyl]anthra[3,2-g]quinoxalin-13-yl]ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-[8,9,10,11-tetrafluoro-6-[2-tri(propan-2-yl)silylethynyl]anthra[3,2-g]quinoxalin-13-yl]ethynyl]silane |
|---|---|
| PubChem CID | 122224272 |
| Molecular Formula | C42H48F4N2Si2 |
| Molecular Weight | 713.02 g/mol |
| Exact Mass | 712.33 |
| IUPAC Name | tri(propan-2-yl)-[2-[8,9,10,11-tetrafluoro-6-[2-tri(propan-2-yl)silylethynyl]anthra[3,2-g]quinoxalin-13-yl]ethynyl]silane |
| SMILES | CC(C)[Si](C#Cc1c2cc3nccnc3cc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cc3c(F)c(F)c(F)c(F)c3cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C42H48F4N2Si2/c1-23(2)49(24(3)4,25(5)6)17-13-29-31-19-35-36(40(44)42(46)41(45)39(35)43)20-32(31)30(14-18-50(26(7)8,27(9)10)28(11)12)34-22-38-37(21-33(29)34)47-15-16-48-38/h15-16,19-28H,1-12H3 |
| InChIKey | OIGVYQQODFBUKH-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.02 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|