C22H22N2O4 — CID 174430284
bis(4-amino-2,3-dihydro-1H-inden-1-yl) (E)-but-2-enedioate (PubChem CID 174430284) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is bis(4-amino-2,3-dihydro-1H-inden-1-yl) (E)-but-2-enedioate.
| Compound Name | bis(4-amino-2,3-dihydro-1H-inden-1-yl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 174430284 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | bis(4-amino-2,3-dihydro-1H-inden-1-yl) (E)-but-2-enedioate |
| SMILES | Nc1cccc2c1CCC2OC(=O)/C=C/C(=O)OC1CCc2c(N)cccc21 |
| InChI | InChI=1S/C22H22N2O4/c23-17-5-1-3-15-13(17)7-9-19(15)27-21(25)11-12-22(26)28-20-10-8-14-16(20)4-2-6-18(14)24/h1-6,11-12,19-20H,7-10,23-24H2/b12-11+ |
| InChIKey | QPNJTYVBYZOCDA-VAWYXSNFSA-N |
| XLogP | 3.17 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|