C17H27BN2O4 — CID 176894691
tert-butyl N-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate (PubChem CID 176894691) has the molecular formula C17H27BN2O4 and a molecular weight of 334.23 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 176894691 |
| Molecular Formula | C17H27BN2O4 |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | tert-butyl N-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)ccnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27BN2O4/c1-11-12(18-23-16(5,6)17(7,8)24-18)9-10-19-13(11)20-14(21)22-15(2,3)4/h9-10H,1-8H3,(H,19,20,21) |
| InChIKey | QUUVKAIUSXIQCS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|