C19H30BN3O4 — CID 168928563
tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridine-1-carboxylate;ethane (PubChem CID 168928563) has the molecular formula C19H30BN3O4 and a molecular weight of 375.28 g/mol. Its IUPAC name is tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 168928563 |
| Molecular Formula | C19H30BN3O4 |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)n1ncc2c(B3OC(C)(C)C(C)(C)O3)ccnc21 |
| InChI | InChI=1S/C17H24BN3O4.C2H6/c1-15(2,3)23-14(22)21-13-11(10-20-21)12(8-9-19-13)18-24-16(4,5)17(6,7)25-18;1-2/h8-10H,1-7H3;1-2H3 |
| InChIKey | AWMYLNUBSRTLKU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|