C24H38BN3O5 — CID 169121227
tert-butyl N-[2-hydroxy-2-methyl-3-[2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]-N-methylcarbamate (PubChem CID 169121227) has the molecular formula C24H38BN3O5 and a molecular weight of 459.40 g/mol. Its IUPAC name is tert-butyl N-[2-hydroxy-2-methyl-3-[2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-hydroxy-2-methyl-3-[2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 169121227 |
| Molecular Formula | C24H38BN3O5 |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | tert-butyl N-[2-hydroxy-2-methyl-3-[2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]-N-methylcarbamate |
| SMILES | Cc1nc2cccc(B3OC(C)(C)C(C)(C)O3)c2n1CC(C)(O)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38BN3O5/c1-16-26-18-13-11-12-17(25-32-22(5,6)23(7,8)33-25)19(18)28(16)15-24(9,30)14-27(10)20(29)31-21(2,3)4/h11-13,30H,14-15H2,1-10H3 |
| InChIKey | ONDYSIDTLIDPGL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|