C31H44BN3O5 — CID 169121182
tert-butyl N-methyl-N-[3-[2-(2-phenylmethoxyethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]carbamate (PubChem CID 169121182) has the molecular formula C31H44BN3O5 and a molecular weight of 549.52 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[3-[2-(2-phenylmethoxyethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[3-[2-(2-phenylmethoxyethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 169121182 |
| Molecular Formula | C31H44BN3O5 |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | tert-butyl N-methyl-N-[3-[2-(2-phenylmethoxyethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]carbamate |
| SMILES | CN(CCCn1c(CCOCc2ccccc2)nc2cccc(B3OC(C)(C)C(C)(C)O3)c21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H44BN3O5/c1-29(2,3)38-28(36)34(8)19-13-20-35-26(18-21-37-22-23-14-10-9-11-15-23)33-25-17-12-16-24(27(25)35)32-39-30(4,5)31(6,7)40-32/h9-12,14-17H,13,18-22H2,1-8H3 |
| InChIKey | BFTWMDAQJZQZDA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|