C21H24BNO3S — CID 153403227
2-(phenylmethoxymethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole (PubChem CID 153403227) has the molecular formula C21H24BNO3S and a molecular weight of 381.31 g/mol. Its IUPAC name is 2-(phenylmethoxymethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole.
| Compound Name | 2-(phenylmethoxymethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 153403227 |
| Molecular Formula | C21H24BNO3S |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-(phenylmethoxymethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole |
| SMILES | CC1(C)OB(c2cccc3nc(COCc4ccccc4)sc23)OC1(C)C |
| InChI | InChI=1S/C21H24BNO3S/c1-20(2)21(3,4)26-22(25-20)16-11-8-12-17-19(16)27-18(23-17)14-24-13-15-9-6-5-7-10-15/h5-12H,13-14H2,1-4H3 |
| InChIKey | WIWLAXBDJVMGIJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|