C14H11BrN2OS — CID 86643276
5-bromo-2-(phenylmethoxymethyl)-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 86643276) has the molecular formula C14H11BrN2OS and a molecular weight of 335.23 g/mol. Its IUPAC name is 5-bromo-2-(phenylmethoxymethyl)-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 5-bromo-2-(phenylmethoxymethyl)-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 86643276 |
| Molecular Formula | C14H11BrN2OS |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 5-bromo-2-(phenylmethoxymethyl)-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | Brc1ccc2nc(COCc3ccccc3)sc2n1 |
| InChI | InChI=1S/C14H11BrN2OS/c15-12-7-6-11-14(17-12)19-13(16-11)9-18-8-10-4-2-1-3-5-10/h1-7H,8-9H2 |
| InChIKey | FRACAFUCNDPEDJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|