C25H40BN3O5 — CID 169121650
tert-butyl N-[2-ethoxy-3-[2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]-N-methylcarbamate (PubChem CID 169121650) has the molecular formula C25H40BN3O5 and a molecular weight of 473.42 g/mol. Its IUPAC name is tert-butyl N-[2-ethoxy-3-[2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-ethoxy-3-[2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 169121650 |
| Molecular Formula | C25H40BN3O5 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | tert-butyl N-[2-ethoxy-3-[2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]propyl]-N-methylcarbamate |
| SMILES | CCOC(CN(C)C(=O)OC(C)(C)C)Cn1c(C)nc2cccc(B3OC(C)(C)C(C)(C)O3)c21 |
| InChI | InChI=1S/C25H40BN3O5/c1-11-31-18(15-28(10)22(30)32-23(3,4)5)16-29-17(2)27-20-14-12-13-19(21(20)29)26-33-24(6,7)25(8,9)34-26/h12-14,18H,11,15-16H2,1-10H3 |
| InChIKey | CYZVYUORDLPDGW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|