C27H44BNO6 — CID 158099904
tert-butyl N-[(2R)-1-[4,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 158099904) has the molecular formula C27H44BNO6 and a molecular weight of 489.46 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[4,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[4,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 158099904 |
| Molecular Formula | C27H44BNO6 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | tert-butyl N-[(2R)-1-[4,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | Cc1cc(C[C@@H](C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c(B2OC(C)(C)C(C)(C)O2)cc1C |
| InChI | InChI=1S/C27H44BNO6/c1-17-14-20(21(15-18(17)2)28-34-26(10,11)27(12,13)35-28)16-19(3)29(22(30)32-24(4,5)6)23(31)33-25(7,8)9/h14-15,19H,16H2,1-13H3/t19-/m1/s1 |
| InChIKey | JOBYKCBUCQSLEG-LJQANCHMSA-N |
| XLogP | 5.71 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|