C24H38BNO6 — CID 163735401
[4-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 163735401) has the molecular formula C24H38BNO6 and a molecular weight of 447.38 g/mol. Its IUPAC name is [4-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163735401 |
| Molecular Formula | C24H38BNO6 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | [4-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)c(COC(=O)C(C)(C)C)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38BNO6/c1-15-12-17(25-31-23(8,9)24(10,11)32-25)16(14-29-19(27)21(2,3)4)13-18(15)26-20(28)30-22(5,6)7/h12-13H,14H2,1-11H3,(H,26,28) |
| InChIKey | LDDNKKHAFCTASV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|