C12H12N6O2 — CID 169345345
3-[2-(2-hydroxyethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345345) has the molecular formula C12H12N6O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 3-[2-(2-hydroxyethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-(2-hydroxyethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345345 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-[2-(2-hydroxyethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccccc1OCCO)c1nn[nH]n1 |
| InChI | InChI=1S/C12H12N6O2/c13-7-9(12-15-17-18-16-12)8-14-10-3-1-2-4-11(10)20-6-5-19/h1-4,8,14,19H,5-6H2,(H,15,16,17,18) |
| InChIKey | DHVQQZRTCPNGBC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|