C16H18N6O — CID 168543868
3-(2,2-dicyanoethenylamino)-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 168543868) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 3-(2,2-dicyanoethenylamino)-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 3-(2,2-dicyanoethenylamino)-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 168543868 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-(2,2-dicyanoethenylamino)-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(N)=O)cc2NC=C(C#N)C#N)CC1 |
| InChI | InChI=1S/C16H18N6O/c1-21-4-6-22(7-5-21)15-3-2-13(16(19)23)8-14(15)20-11-12(9-17)10-18/h2-3,8,11,20H,4-7H2,1H3,(H2,19,23) |
| InChIKey | RTEYVTDRYWNJBR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|