C42H36F3N3O3S — CID 176633239
[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)phenyl] trifluoromethanesulfonate (PubChem CID 176633239) has the molecular formula C42H36F3N3O3S and a molecular weight of 719.83 g/mol. Its IUPAC name is [2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 176633239 |
| Molecular Formula | C42H36F3N3O3S |
| Molecular Weight | 719.83 g/mol |
| Exact Mass | 719.24 |
| IUPAC Name | [2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C23CC4CC5C6CC(CC52)CC3C6C4)cc1-c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1)C(F)(F)F |
| InChI | InChI=1S/C42H36F3N3O3S/c43-42(44,45)52(49,50)51-37-16-15-30(41-23-25-18-33-32-17-24(20-35(33)41)21-36(41)34(32)19-25)22-31(37)26-11-13-29(14-12-26)40-47-38(27-7-3-1-4-8-27)46-39(48-40)28-9-5-2-6-10-28/h1-16,22,24-25,32-36H,17-21,23H2 |
| InChIKey | FOHXKLGLNQICPP-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.83 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|