C22H22F3NO3S — CID 169054814
[4-(1-adamantyl)-2-pyridin-3-ylphenyl] trifluoromethanesulfonate (PubChem CID 169054814) has the molecular formula C22H22F3NO3S and a molecular weight of 437.48 g/mol. Its IUPAC name is [4-(1-adamantyl)-2-pyridin-3-ylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-(1-adamantyl)-2-pyridin-3-ylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 169054814 |
| Molecular Formula | C22H22F3NO3S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [4-(1-adamantyl)-2-pyridin-3-ylphenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C23CC4CC(CC(C4)C2)C3)cc1-c1cccnc1)C(F)(F)F |
| InChI | InChI=1S/C22H22F3NO3S/c23-22(24,25)30(27,28)29-20-4-3-18(9-19(20)17-2-1-5-26-13-17)21-10-14-6-15(11-21)8-16(7-14)12-21/h1-5,9,13-16H,6-8,10-12H2 |
| InChIKey | KEQOBBCIYZPECZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|