C48H46O10 — CID 67506666
4-[4-(1-adamantyl)-2-[5-(1-adamantyl)-2-(3,4-dicarboxyphenoxy)phenyl]phenoxy]phthalic acid (PubChem CID 67506666) has the molecular formula C48H46O10 and a molecular weight of 782.89 g/mol. Its IUPAC name is 4-[4-(1-adamantyl)-2-[5-(1-adamantyl)-2-(3,4-dicarboxyphenoxy)phenyl]phenoxy]phthalic acid.
| Compound Name | 4-[4-(1-adamantyl)-2-[5-(1-adamantyl)-2-(3,4-dicarboxyphenoxy)phenyl]phenoxy]phthalic acid |
|---|---|
| PubChem CID | 67506666 |
| Molecular Formula | C48H46O10 |
| Molecular Weight | 782.89 g/mol |
| Exact Mass | 782.31 |
| IUPAC Name | 4-[4-(1-adamantyl)-2-[5-(1-adamantyl)-2-(3,4-dicarboxyphenoxy)phenyl]phenoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(Oc2ccc(C34CC5CC(CC(C5)C3)C4)cc2-c2cc(C34CC5CC(CC(C5)C3)C4)ccc2Oc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C48H46O10/c49-43(50)35-5-3-33(17-39(35)45(53)54)57-41-7-1-31(47-19-25-9-26(20-47)11-27(10-25)21-47)15-37(41)38-16-32(48-22-28-12-29(23-48)14-30(13-28)24-48)2-8-42(38)58-34-4-6-36(44(51)52)40(18-34)46(55)56/h1-8,15-18,25-30H,9-14,19-24H2,(H,49,50)(H,51,52)(H,53,54)(H,55,56) |
| InChIKey | QUMHGBXZBIKHQB-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.89 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |