C61H54O10 — CID 87425447
4-[4-[2,7-bis(1-adamantyl)-9-[4-(3,4-dicarboxyphenoxy)phenyl]fluoren-9-yl]phenoxy]phthalic acid (PubChem CID 87425447) has the molecular formula C61H54O10 and a molecular weight of 947.09 g/mol. Its IUPAC name is 4-[4-[2,7-bis(1-adamantyl)-9-[4-(3,4-dicarboxyphenoxy)phenyl]fluoren-9-yl]phenoxy]phthalic acid.
| Compound Name | 4-[4-[2,7-bis(1-adamantyl)-9-[4-(3,4-dicarboxyphenoxy)phenyl]fluoren-9-yl]phenoxy]phthalic acid |
|---|---|
| PubChem CID | 87425447 |
| Molecular Formula | C61H54O10 |
| Molecular Weight | 947.09 g/mol |
| Exact Mass | 946.37 |
| IUPAC Name | 4-[4-[2,7-bis(1-adamantyl)-9-[4-(3,4-dicarboxyphenoxy)phenyl]fluoren-9-yl]phenoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(Oc2ccc(C3(c4ccc(Oc5ccc(C(=O)O)c(C(=O)O)c5)cc4)c4cc(C56CC7CC(CC(C7)C5)C6)ccc4-c4ccc(C56CC7CC(CC(C7)C5)C6)cc43)cc2)cc1C(=O)O |
| InChI | InChI=1S/C61H54O10/c62-55(63)49-15-11-45(25-51(49)57(66)67)70-43-7-1-39(2-8-43)61(40-3-9-44(10-4-40)71-46-12-16-50(56(64)65)52(26-46)58(68)69)53-23-41(59-27-33-17-34(28-59)19-35(18-33)29-59)5-13-47(53)48-14-6-42(24-54(48)61)60-30-36-20-37(31-60)22-38(21-36)32-60/h1-16,23-26,33-38H,17-22,27-32H2,(H,62,63)(H,64,65)(H,66,67)(H,68,69) |
| InChIKey | KRTLRYFIAFHHRT-UHFFFAOYSA-N |
| XLogP | 13.36 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.09 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |