C61H56N2O4 — CID 67520398
2-amino-5-[4-[2,7-bis[2-(1-adamantyl)ethynyl]-9-[4-(4-amino-3-hydroxyphenoxy)phenyl]fluoren-9-yl]phenoxy]phenol (PubChem CID 67520398) has the molecular formula C61H56N2O4 and a molecular weight of 881.13 g/mol. Its IUPAC name is 2-amino-5-[4-[2,7-bis[2-(1-adamantyl)ethynyl]-9-[4-(4-amino-3-hydroxyphenoxy)phenyl]fluoren-9-yl]phenoxy]phenol.
| Compound Name | 2-amino-5-[4-[2,7-bis[2-(1-adamantyl)ethynyl]-9-[4-(4-amino-3-hydroxyphenoxy)phenyl]fluoren-9-yl]phenoxy]phenol |
|---|---|
| PubChem CID | 67520398 |
| Molecular Formula | C61H56N2O4 |
| Molecular Weight | 881.13 g/mol |
| Exact Mass | 880.42 |
| IUPAC Name | 2-amino-5-[4-[2,7-bis[2-(1-adamantyl)ethynyl]-9-[4-(4-amino-3-hydroxyphenoxy)phenyl]fluoren-9-yl]phenoxy]phenol |
| SMILES | Nc1ccc(Oc2ccc(C3(c4ccc(Oc5ccc(N)c(O)c5)cc4)c4cc(C#CC56CC7CC(CC(C7)C5)C6)ccc4-c4ccc(C#CC56CC7CC(CC(C7)C5)C6)cc43)cc2)cc1O |
| InChI | InChI=1S/C61H56N2O4/c62-55-15-11-49(29-57(55)64)66-47-7-3-45(4-8-47)61(46-5-9-48(10-6-46)67-50-12-16-56(63)58(65)30-50)53-27-37(17-19-59-31-39-21-40(32-59)23-41(22-39)33-59)1-13-51(53)52-14-2-38(28-54(52)61)18-20-60-34-42-24-43(35-60)26-44(25-42)36-60/h1-16,27-30,39-44,64-65H,21-26,31-36,62-63H2 |
| InChIKey | URTKGDLZODRWRX-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.13 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|