C59H56N2O4 — CID 87430945
2-amino-5-[4-[2,7-bis(1-adamantyl)-9-[4-(4-amino-3-hydroxyphenoxy)phenyl]-1-ethynylfluoren-9-yl]phenoxy]phenol (PubChem CID 87430945) has the molecular formula C59H56N2O4 and a molecular weight of 857.11 g/mol. Its IUPAC name is 2-amino-5-[4-[2,7-bis(1-adamantyl)-9-[4-(4-amino-3-hydroxyphenoxy)phenyl]-1-ethynylfluoren-9-yl]phenoxy]phenol.
| Compound Name | 2-amino-5-[4-[2,7-bis(1-adamantyl)-9-[4-(4-amino-3-hydroxyphenoxy)phenyl]-1-ethynylfluoren-9-yl]phenoxy]phenol |
|---|---|
| PubChem CID | 87430945 |
| Molecular Formula | C59H56N2O4 |
| Molecular Weight | 857.11 g/mol |
| Exact Mass | 856.42 |
| IUPAC Name | 2-amino-5-[4-[2,7-bis(1-adamantyl)-9-[4-(4-amino-3-hydroxyphenoxy)phenyl]-1-ethynylfluoren-9-yl]phenoxy]phenol |
| SMILES | C#Cc1c(C23CC4CC(CC(C4)C2)C3)ccc2c1C(c1ccc(Oc3ccc(N)c(O)c3)cc1)(c1ccc(Oc3ccc(N)c(O)c3)cc1)c1cc(C34CC5CC(CC(C5)C3)C4)ccc1-2 |
| InChI | InChI=1S/C59H56N2O4/c1-2-47-50(58-31-37-22-38(32-58)24-39(23-37)33-58)16-15-49-48-14-7-42(57-28-34-19-35(29-57)21-36(20-34)30-57)25-51(48)59(56(47)49,40-3-8-43(9-4-40)64-45-12-17-52(60)54(62)26-45)41-5-10-44(11-6-41)65-46-13-18-53(61)55(63)27-46/h1,3-18,25-27,34-39,62-63H,19-24,28-33,60-61H2 |
| InChIKey | LQPUFWWAVVZJPL-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.11 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|