C45H28N2O4 — CID 139999286
2-amino-4-[4-[9-[4-(3-amino-4-hydroxyphenoxy)phenyl]-1,4,5,8-tetraethynylfluoren-9-yl]phenoxy]phenol (PubChem CID 139999286) has the molecular formula C45H28N2O4 and a molecular weight of 660.73 g/mol. Its IUPAC name is 2-amino-4-[4-[9-[4-(3-amino-4-hydroxyphenoxy)phenyl]-1,4,5,8-tetraethynylfluoren-9-yl]phenoxy]phenol.
| Compound Name | 2-amino-4-[4-[9-[4-(3-amino-4-hydroxyphenoxy)phenyl]-1,4,5,8-tetraethynylfluoren-9-yl]phenoxy]phenol |
|---|---|
| PubChem CID | 139999286 |
| Molecular Formula | C45H28N2O4 |
| Molecular Weight | 660.73 g/mol |
| Exact Mass | 660.20 |
| IUPAC Name | 2-amino-4-[4-[9-[4-(3-amino-4-hydroxyphenoxy)phenyl]-1,4,5,8-tetraethynylfluoren-9-yl]phenoxy]phenol |
| SMILES | C#Cc1ccc(C#C)c2c1-c1c(C#C)ccc(C#C)c1C2(c1ccc(Oc2ccc(O)c(N)c2)cc1)c1ccc(Oc2ccc(O)c(N)c2)cc1 |
| InChI | InChI=1S/C45H28N2O4/c1-5-27-9-11-29(7-3)43-41(27)42-28(6-2)10-12-30(8-4)44(42)45(43,31-13-17-33(18-14-31)50-35-21-23-39(48)37(46)25-35)32-15-19-34(20-16-32)51-36-22-24-40(49)38(47)26-36/h1-4,9-26,48-49H,46-47H2 |
| InChIKey | YUSTUIWFJYYNTJ-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.73 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|