C20H16N2O4 — CID 139999193
2-amino-4-[3-(3-amino-4-hydroxyphenoxy)-2-ethynylphenoxy]phenol (PubChem CID 139999193) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-amino-4-[3-(3-amino-4-hydroxyphenoxy)-2-ethynylphenoxy]phenol.
| Compound Name | 2-amino-4-[3-(3-amino-4-hydroxyphenoxy)-2-ethynylphenoxy]phenol |
|---|---|
| PubChem CID | 139999193 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-amino-4-[3-(3-amino-4-hydroxyphenoxy)-2-ethynylphenoxy]phenol |
| SMILES | C#Cc1c(Oc2ccc(O)c(N)c2)cccc1Oc1ccc(O)c(N)c1 |
| InChI | InChI=1S/C20H16N2O4/c1-2-14-19(25-12-6-8-17(23)15(21)10-12)4-3-5-20(14)26-13-7-9-18(24)16(22)11-13/h1,3-11,23-24H,21-22H2 |
| InChIKey | RJHNFUSEFROMDD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|