C38H26N2O4 — CID 139999464
2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-7,8-bis(2-phenylethynyl)naphthalen-1-yl]oxyphenol (PubChem CID 139999464) has the molecular formula C38H26N2O4 and a molecular weight of 574.64 g/mol. Its IUPAC name is 2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-7,8-bis(2-phenylethynyl)naphthalen-1-yl]oxyphenol.
| Compound Name | 2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-7,8-bis(2-phenylethynyl)naphthalen-1-yl]oxyphenol |
|---|---|
| PubChem CID | 139999464 |
| Molecular Formula | C38H26N2O4 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-7,8-bis(2-phenylethynyl)naphthalen-1-yl]oxyphenol |
| SMILES | Nc1cc(Oc2cc(C#Cc3ccccc3)c(C#Cc3ccccc3)c3c(Oc4ccc(O)c(N)c4)cccc23)ccc1O |
| InChI | InChI=1S/C38H26N2O4/c39-32-23-28(17-20-34(32)41)43-36-13-7-12-31-37(44-29-18-21-35(42)33(40)24-29)22-27(16-14-25-8-3-1-4-9-25)30(38(31)36)19-15-26-10-5-2-6-11-26/h1-13,17-18,20-24,41-42H,39-40H2 |
| InChIKey | JOKPIFLGYKGVGB-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|