C54H34N2O4 — CID 139999397
2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-3,4,7,8-tetrakis(2-phenylethynyl)naphthalen-1-yl]oxyphenol (PubChem CID 139999397) has the molecular formula C54H34N2O4 and a molecular weight of 774.88 g/mol. Its IUPAC name is 2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-3,4,7,8-tetrakis(2-phenylethynyl)naphthalen-1-yl]oxyphenol.
| Compound Name | 2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-3,4,7,8-tetrakis(2-phenylethynyl)naphthalen-1-yl]oxyphenol |
|---|---|
| PubChem CID | 139999397 |
| Molecular Formula | C54H34N2O4 |
| Molecular Weight | 774.88 g/mol |
| Exact Mass | 774.25 |
| IUPAC Name | 2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-3,4,7,8-tetrakis(2-phenylethynyl)naphthalen-1-yl]oxyphenol |
| SMILES | Nc1cc(Oc2cc(C#Cc3ccccc3)c(C#Cc3ccccc3)c3c(Oc4ccc(O)c(N)c4)cc(C#Cc4ccccc4)c(C#Cc4ccccc4)c23)ccc1O |
| InChI | InChI=1S/C54H34N2O4/c55-47-35-43(27-31-49(47)57)59-51-33-41(25-21-37-13-5-1-6-14-37)45(29-23-39-17-9-3-10-18-39)53-52(60-44-28-32-50(58)48(56)36-44)34-42(26-22-38-15-7-2-8-16-38)46(54(51)53)30-24-40-19-11-4-12-20-40/h1-20,27-28,31-36,57-58H,55-56H2 |
| InChIKey | YVHZPXIBYAZZDR-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.88 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|