C28H18N2O4 — CID 139999420
2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-2,6,8-triethynylnaphthalen-1-yl]oxyphenol (PubChem CID 139999420) has the molecular formula C28H18N2O4 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-2,6,8-triethynylnaphthalen-1-yl]oxyphenol.
| Compound Name | 2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-2,6,8-triethynylnaphthalen-1-yl]oxyphenol |
|---|---|
| PubChem CID | 139999420 |
| Molecular Formula | C28H18N2O4 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-amino-4-[5-(3-amino-4-hydroxyphenoxy)-2,6,8-triethynylnaphthalen-1-yl]oxyphenol |
| SMILES | C#Cc1cc(C#C)c2c(Oc3ccc(O)c(N)c3)c(C#C)ccc2c1Oc1ccc(O)c(N)c1 |
| InChI | InChI=1S/C28H18N2O4/c1-4-16-7-10-21-26(28(16)34-20-9-12-25(32)23(30)15-20)17(5-2)13-18(6-3)27(21)33-19-8-11-24(31)22(29)14-19/h1-3,7-15,31-32H,29-30H2 |
| InChIKey | NIQZQBIXGGQDGB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|