C39H28F3NO3 — CID 22979019
2-amino-5-[4-[9-[4-[4-methyl-2-(trifluoromethyl)phenoxy]phenyl]fluoren-9-yl]phenoxy]phenol (PubChem CID 22979019) has the molecular formula C39H28F3NO3 and a molecular weight of 615.65 g/mol. Its IUPAC name is 2-amino-5-[4-[9-[4-[4-methyl-2-(trifluoromethyl)phenoxy]phenyl]fluoren-9-yl]phenoxy]phenol.
| Compound Name | 2-amino-5-[4-[9-[4-[4-methyl-2-(trifluoromethyl)phenoxy]phenyl]fluoren-9-yl]phenoxy]phenol |
|---|---|
| PubChem CID | 22979019 |
| Molecular Formula | C39H28F3NO3 |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | 2-amino-5-[4-[9-[4-[4-methyl-2-(trifluoromethyl)phenoxy]phenyl]fluoren-9-yl]phenoxy]phenol |
| SMILES | Cc1ccc(Oc2ccc(C3(c4ccc(Oc5ccc(N)c(O)c5)cc4)c4ccccc4-c4ccccc43)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C39H28F3NO3/c1-24-10-21-37(34(22-24)39(40,41)42)46-28-17-13-26(14-18-28)38(32-8-4-2-6-30(32)31-7-3-5-9-33(31)38)25-11-15-27(16-12-25)45-29-19-20-35(43)36(44)23-29/h2-23,44H,43H2,1H3 |
| InChIKey | ONFJTBOQSNMHKL-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|