C38H28N2O4 — CID 139816339
9,9-bis[4-(2-aminophenoxy)phenyl]fluorene-3-carboxylic acid (PubChem CID 139816339) has the molecular formula C38H28N2O4 and a molecular weight of 576.65 g/mol. Its IUPAC name is 9,9-bis[4-(2-aminophenoxy)phenyl]fluorene-3-carboxylic acid.
| Compound Name | 9,9-bis[4-(2-aminophenoxy)phenyl]fluorene-3-carboxylic acid |
|---|---|
| PubChem CID | 139816339 |
| Molecular Formula | C38H28N2O4 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 9,9-bis[4-(2-aminophenoxy)phenyl]fluorene-3-carboxylic acid |
| SMILES | Nc1ccccc1Oc1ccc(C2(c3ccc(Oc4ccccc4N)cc3)c3ccccc3-c3cc(C(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C38H28N2O4/c39-33-9-3-5-11-35(33)43-27-18-14-25(15-19-27)38(26-16-20-28(21-17-26)44-36-12-6-4-10-34(36)40)31-8-2-1-7-29(31)30-23-24(37(41)42)13-22-32(30)38/h1-23H,39-40H2,(H,41,42) |
| InChIKey | OKYGUNWVUJSNPZ-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|