C51H34O6 — CID 69231179
4-[4-[9-[4-(4-carboxyphenoxy)-3-phenylphenyl]fluoren-9-yl]-2-phenylphenoxy]benzoic acid (PubChem CID 69231179) has the molecular formula C51H34O6 and a molecular weight of 742.83 g/mol. Its IUPAC name is 4-[4-[9-[4-(4-carboxyphenoxy)-3-phenylphenyl]fluoren-9-yl]-2-phenylphenoxy]benzoic acid.
| Compound Name | 4-[4-[9-[4-(4-carboxyphenoxy)-3-phenylphenyl]fluoren-9-yl]-2-phenylphenoxy]benzoic acid |
|---|---|
| PubChem CID | 69231179 |
| Molecular Formula | C51H34O6 |
| Molecular Weight | 742.83 g/mol |
| Exact Mass | 742.24 |
| IUPAC Name | 4-[4-[9-[4-(4-carboxyphenoxy)-3-phenylphenyl]fluoren-9-yl]-2-phenylphenoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(Oc2ccc(C3(c4ccc(Oc5ccc(C(=O)O)cc5)c(-c5ccccc5)c4)c4ccccc4-c4ccccc43)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C51H34O6/c52-49(53)35-19-25-39(26-20-35)56-47-29-23-37(31-43(47)33-11-3-1-4-12-33)51(45-17-9-7-15-41(45)42-16-8-10-18-46(42)51)38-24-30-48(44(32-38)34-13-5-2-6-14-34)57-40-27-21-36(22-28-40)50(54)55/h1-32H,(H,52,53)(H,54,55) |
| InChIKey | IBJYRESTWCEYGT-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.83 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |