C17H20O4 — CID 122509295
4-(1-adamantyl)-2,3-dihydroxybenzoic acid (PubChem CID 122509295) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-(1-adamantyl)-2,3-dihydroxybenzoic acid.
| Compound Name | 4-(1-adamantyl)-2,3-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 122509295 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-(1-adamantyl)-2,3-dihydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(C23CC4CC(CC(C4)C2)C3)c(O)c1O |
| InChI | InChI=1S/C17H20O4/c18-14-12(16(20)21)1-2-13(15(14)19)17-6-9-3-10(7-17)5-11(4-9)8-17/h1-2,9-11,18-19H,3-8H2,(H,20,21) |
| InChIKey | IBRHZDFARPKLEF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|