C18H22N2O3 — CID 141262153
2-(1-adamantyl)-3-hydroxybenzene-1,4-dicarboxamide (PubChem CID 141262153) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-(1-adamantyl)-3-hydroxybenzene-1,4-dicarboxamide.
| Compound Name | 2-(1-adamantyl)-3-hydroxybenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 141262153 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-(1-adamantyl)-3-hydroxybenzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)c(C23CC4CC(CC(C4)C2)C3)c1O |
| InChI | InChI=1S/C18H22N2O3/c19-16(22)12-1-2-13(17(20)23)15(21)14(12)18-6-9-3-10(7-18)5-11(4-9)8-18/h1-2,9-11,21H,3-8H2,(H2,19,22)(H2,20,23) |
| InChIKey | PTIZWLNETZKNGN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |