C38H32O10 — CID 67507107
4-[2-[2-[2-(3,4-dicarboxyphenoxy)phenyl]-2-adamantyl]phenoxy]phthalic acid (PubChem CID 67507107) has the molecular formula C38H32O10 and a molecular weight of 648.66 g/mol. Its IUPAC name is 4-[2-[2-[2-(3,4-dicarboxyphenoxy)phenyl]-2-adamantyl]phenoxy]phthalic acid.
| Compound Name | 4-[2-[2-[2-(3,4-dicarboxyphenoxy)phenyl]-2-adamantyl]phenoxy]phthalic acid |
|---|---|
| PubChem CID | 67507107 |
| Molecular Formula | C38H32O10 |
| Molecular Weight | 648.66 g/mol |
| Exact Mass | 648.20 |
| IUPAC Name | 4-[2-[2-[2-(3,4-dicarboxyphenoxy)phenyl]-2-adamantyl]phenoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(Oc2ccccc2C2(c3ccccc3Oc3ccc(C(=O)O)c(C(=O)O)c3)C3CC4CC(C3)CC2C4)cc1C(=O)O |
| InChI | InChI=1S/C38H32O10/c39-34(40)26-11-9-24(18-28(26)36(43)44)47-32-7-3-1-5-30(32)38(22-14-20-13-21(16-22)17-23(38)15-20)31-6-2-4-8-33(31)48-25-10-12-27(35(41)42)29(19-25)37(45)46/h1-12,18-23H,13-17H2,(H,39,40)(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | KXQMECRWSUCVDJ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.66 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |