About 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid
4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid (PubChem CID 67507253) has the molecular formula C26H24O10
and a molecular weight of 496.47 g/mol. Its IUPAC name is 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid.
Molecular Properties
| Compound Name | 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid |
| PubChem CID | 67507253 |
| Molecular Formula | C26H24O10 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid |
| SMILES | O=C(O)c1ccc(OC2(Oc3ccc(C(=O)O)c(C(=O)O)c3)C3CC4CC(C3)CC2C4)cc1C(=O)O |
| InChI | InChI=1S/C26H24O10/c27-22(28)18-3-1-16(10-20(18)24(31)32)35-26(14-6-12-5-13(8-14)9-15(26)7-12)36-17-2-4-19(23(29)30)21(11-17)25(33)34/h1-4,10-15H,5-9H2,(H,27,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | UUEBAHUSUQZNDE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid?
The IUPAC name of 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid (CID 67507253) is 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid.
What is the SMILES notation for 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid?
The canonical SMILES for 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid is O=C(O)c1ccc(OC2(Oc3ccc(C(=O)O)c(C(=O)O)c3)C3CC4CC(C3)CC2C4)cc1C(=O)O.
What is the InChIKey of 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid?
The InChIKey is UUEBAHUSUQZNDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24O10/c27-22(28)18-3-1-16(10-20(18)24(31)32)35-26(14-6-12-5-13(8-14)9-15(26)7-12)36-17-2-4-19(23(29)30)21(11-17)25(33)34/h1-4,10-15H,5-9H2,(H,27,28)(H,29,30)(H,31,32)(H,33,34).
What are the key properties of 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid?
4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid has a molecular weight of 496.47 g/mol, XLogP of 4.09, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(3,4-dicarboxyphenoxy)-2-adamantyl]oxy]phthalic acid is sourced from PubChem (CID 67507253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).