C24H14O13 — CID 141143576
4-[[7a-(3,4-dicarboxyphenoxy)-1,3-dioxo-3aH-2-benzofuran-4-yl]oxy]phthalic acid (PubChem CID 141143576) has the molecular formula C24H14O13 and a molecular weight of 510.36 g/mol. Its IUPAC name is 4-[[7a-(3,4-dicarboxyphenoxy)-1,3-dioxo-3aH-2-benzofuran-4-yl]oxy]phthalic acid.
| Compound Name | 4-[[7a-(3,4-dicarboxyphenoxy)-1,3-dioxo-3aH-2-benzofuran-4-yl]oxy]phthalic acid |
|---|---|
| PubChem CID | 141143576 |
| Molecular Formula | C24H14O13 |
| Molecular Weight | 510.36 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | 4-[[7a-(3,4-dicarboxyphenoxy)-1,3-dioxo-3aH-2-benzofuran-4-yl]oxy]phthalic acid |
| SMILES | O=C(O)c1ccc(OC2=CC=CC3(Oc4ccc(C(=O)O)c(C(=O)O)c4)C(=O)OC(=O)C23)cc1C(=O)O |
| InChI | InChI=1S/C24H14O13/c25-18(26)12-5-3-10(8-14(12)20(29)30)35-16-2-1-7-24(17(16)22(33)36-23(24)34)37-11-4-6-13(19(27)28)15(9-11)21(31)32/h1-9,17H,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | MQJUIYIQEUTKRS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 211.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|